2,3-Dihydroxycinnamic acid
2,3-Dihydroxycinnamic acid
|
Names |
IUPAC name
(E)-3-(2,3-Dihydroxyphenyl)prop-2-enoic acid |
Other names
trans-2,3-Dihydroxycinnamate 3-(2,3-Dihydroxyphenyl)acrylic acid |
Identifiers |
|
31082-90-3 |
3D model (Jmol) |
Interactive image |
ChemSpider |
4445343 |
PubChem |
5282146 |
InChI=1S/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)/b5-4+ Key: SIUKXCMDYPYCLH-SNAWJCMRSA-N InChI=1/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)/b5-4+ Key: SIUKXCMDYPYCLH-SNAWJCMRBO
|
c1cc(c(c(c1)O)O)/C=C/C(=O)O
|
Properties |
|
C9H8O4 |
Molar mass |
180.16 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references |
|
|
2,3-Dihydroxycinnamic acid is a hydroxycinnamic acid. It is an isomer of caffeic acid.
It is a metabolite found in human urine.[1]
References
- ↑ Heindl, A; Rau, O; Spiteller, G (1985). "Identification of aromatic dihydroxy acids in biological fluids". Biomedical mass spectrometry. 12 (2): 59–66. PMID 3158357.
|
---|
|
Aglycones | Precursor | |
---|
| Monohydroxycinnamic acids (Coumaric acids) | |
---|
| | |
---|
| Trihydroxycinnamic acids | |
---|
| O-methylated forms | |
---|
| others | |
---|
|
---|
|
Esters | glycoside-likes | Esters of caffeic acid with cyclitols | esters of quinic acid |
- Chlorogenic acid (3-caffeoylquinic acid)
- Cryptochlorogenic acid (4-O-caffeoylquinic acid)
- Neochlorogenic acid (5-O-Caffeoylquinic acid)
- Cynarine (1,5-dicaffeoylquinic acid)
- 3,4-dicaffeoylquinic acid
- 3,5-dicaffeoylquinic acid
|
---|
| esters of shikimic acid | |
---|
|
---|
| Glycosides | |
---|
|
---|
| Tartaric acid esters | |
---|
| Other esters with caffeic acid | |
---|
| Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C and F
- Chiritoside A, B and C
- Cistanoside A, B, C, D, E, F, G an H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2'-Acetylverbascoside)
|
---|
|
---|
|
Oligomeric forms | Dimers |
- Diferulic acids (DiFA) : 5,5'-Diferulic acid, 8-O-4'-Diferulic acid, 8,5'-Diferulic acid, 8,5'-DiFA (DC), 8,5'-DiFA (BF), 8,8'-Diferulic acid
|
---|
| Trimers | |
---|
| Tetramers | |
---|
|
---|
|
Conjugates with coenzyme A (CoA) | |
---|